C20H19NSSi — CID 166018634
trimethyl-(3-phenyl-[1]benzothiolo[2,3-c]pyridin-7-yl)silane (PubChem CID 166018634) has the molecular formula C20H19NSSi and a molecular weight of 333.53 g/mol. Its IUPAC name is trimethyl-(3-phenyl-[1]benzothiolo[2,3-c]pyridin-7-yl)silane.
| Compound Name | trimethyl-(3-phenyl-[1]benzothiolo[2,3-c]pyridin-7-yl)silane |
|---|---|
| PubChem CID | 166018634 |
| Molecular Formula | C20H19NSSi |
| Molecular Weight | 333.53 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | trimethyl-(3-phenyl-[1]benzothiolo[2,3-c]pyridin-7-yl)silane |
| SMILES | C[Si](C)(C)c1ccc2c(c1)sc1cnc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C20H19NSSi/c1-23(2,3)15-9-10-16-17-12-18(14-7-5-4-6-8-14)21-13-20(17)22-19(16)11-15/h4-13H,1-3H3 |
| InChIKey | KDIZQPCNZOYFON-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|