C20H29NSi — CID 155611943
[4-(2,2-dimethylpropyl)-6-(3-methylphenyl)-3-pyridinyl]-trimethylsilane (PubChem CID 155611943) has the molecular formula C20H29NSi and a molecular weight of 311.55 g/mol. Its IUPAC name is [4-(2,2-dimethylpropyl)-6-(3-methylphenyl)-3-pyridinyl]-trimethylsilane.
| Compound Name | [4-(2,2-dimethylpropyl)-6-(3-methylphenyl)-3-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 155611943 |
| Molecular Formula | C20H29NSi |
| Molecular Weight | 311.55 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | [4-(2,2-dimethylpropyl)-6-(3-methylphenyl)-3-pyridinyl]-trimethylsilane |
| SMILES | Cc1cccc(-c2cc(CC(C)(C)C)c([Si](C)(C)C)cn2)c1 |
| InChI | InChI=1S/C20H29NSi/c1-15-9-8-10-16(11-15)18-12-17(13-20(2,3)4)19(14-21-18)22(5,6)7/h8-12,14H,13H2,1-7H3 |
| InChIKey | HLHUKTSMKRIUNU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.55 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|