C25H37NSi — CID 154591896
[6-[4-tert-butyl-2-(trideuteriomethyl)phenyl]-4-(cyclopentylmethyl)-3-pyridinyl]-trimethylsilane (PubChem CID 154591896) has the molecular formula C25H37NSi and a molecular weight of 382.68 g/mol. Its IUPAC name is [6-[4-tert-butyl-2-(trideuteriomethyl)phenyl]-4-(cyclopentylmethyl)-3-pyridinyl]-trimethylsilane.
| Compound Name | [6-[4-tert-butyl-2-(trideuteriomethyl)phenyl]-4-(cyclopentylmethyl)-3-pyridinyl]-trimethylsilane |
|---|---|
| PubChem CID | 154591896 |
| Molecular Formula | C25H37NSi |
| Molecular Weight | 382.68 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | [6-[4-tert-butyl-2-(trideuteriomethyl)phenyl]-4-(cyclopentylmethyl)-3-pyridinyl]-trimethylsilane |
| SMILES | [2H]C([2H])([2H])c1cc(C(C)(C)C)ccc1-c1cc(CC2CCCC2)c([Si](C)(C)C)cn1 |
| InChI | InChI=1S/C25H37NSi/c1-18-14-21(25(2,3)4)12-13-22(18)23-16-20(15-19-10-8-9-11-19)24(17-26-23)27(5,6)7/h12-14,16-17,19H,8-11,15H2,1-7H3/i1D3 |
| InChIKey | CUYJJCZACBGBET-FIBGUPNXSA-N |
| XLogP | 6.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.68 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|