C50H51IrN3SSi-2 — CID 156657533
1-(4-tert-butylphenyl)-2-(4H-dibenzothiophen-4-id-3-yl)benzimidazole;[4-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 156657533) has the molecular formula C50H51IrN3SSi-2 and a molecular weight of 946.35 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2-(4H-dibenzothiophen-4-id-3-yl)benzimidazole;[4-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | 1-(4-tert-butylphenyl)-2-(4H-dibenzothiophen-4-id-3-yl)benzimidazole;[4-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 156657533 |
| Molecular Formula | C50H51IrN3SSi-2 |
| Molecular Weight | 946.35 g/mol |
| Exact Mass | 946.32 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2-(4H-dibenzothiophen-4-id-3-yl)benzimidazole;[4-(cyclohexylmethyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3[c-]c4sc5ccccc5c4cc3)nc3ccccc32)cc1.C[Si](C)(C)c1cnc(-c2[c-]cccc2)cc1CC1CCCCC1.[Ir] |
| InChI | InChI=1S/C29H23N2S.C21H28NSi.Ir/c1-29(2,3)20-13-15-21(16-14-20)31-25-10-6-5-9-24(25)30-28(31)19-12-17-23-22-8-4-7-11-26(22)32-27(23)18-19;1-23(2,3)21-16-22-20(18-12-8-5-9-13-18)15-19(21)14-17-10-6-4-7-11-17;/h4-17H,1-3H3;5,8-9,12,15-17H,4,6-7,10-11,14H2,1-3H3;/q2*-1; |
| InChIKey | MDYQNIAZRKHNQC-UHFFFAOYSA-N |
| XLogP | 13.37 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 946.35 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|