C48H50IrN4OSi-2 — CID 156671229
4-[1-(4-tert-butylphenyl)benzimidazol-2-yl]-7-methyl-3H-[1]benzofuro[3,2-c]pyridin-3-ide;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium (PubChem CID 156671229) has the molecular formula C48H50IrN4OSi-2 and a molecular weight of 919.26 g/mol. Its IUPAC name is 4-[1-(4-tert-butylphenyl)benzimidazol-2-yl]-7-methyl-3H-[1]benzofuro[3,2-c]pyridin-3-ide;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium.
| Compound Name | 4-[1-(4-tert-butylphenyl)benzimidazol-2-yl]-7-methyl-3H-[1]benzofuro[3,2-c]pyridin-3-ide;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
|---|---|
| PubChem CID | 156671229 |
| Molecular Formula | C48H50IrN4OSi-2 |
| Molecular Weight | 919.26 g/mol |
| Exact Mass | 919.34 |
| IUPAC Name | 4-[1-(4-tert-butylphenyl)benzimidazol-2-yl]-7-methyl-3H-[1]benzofuro[3,2-c]pyridin-3-ide;[4-(2,2-dimethylpropyl)-6-phenyl-3-pyridinyl]-trimethylsilane;iridium |
| SMILES | CC(C)(C)Cc1cc(-c2[c-]cccc2)ncc1[Si](C)(C)C.Cc1ccc2c(c1)oc1c(-c3nc4ccccc4n3-c3ccc(C(C)(C)C)cc3)[c-]ncc12.[Ir] |
| InChI | InChI=1S/C29H24N3O.C19H26NSi.Ir/c1-18-9-14-21-22-16-30-17-23(27(22)33-26(21)15-18)28-31-24-7-5-6-8-25(24)32(28)20-12-10-19(11-13-20)29(2,3)4;1-19(2,3)13-16-12-17(15-10-8-7-9-11-15)20-14-18(16)21(4,5)6;/h5-16H,1-4H3;7-10,12,14H,13H2,1-6H3;/q2*-1; |
| InChIKey | WAOMJSXGYZOHRW-UHFFFAOYSA-N |
| XLogP | 12.07 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.26 |
| LogP ≤ 5 | 12.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|