C24H18BrN — CID 134944928
4-(4-bromophenyl)-6-methyl-2,3-diphenylpyridine (PubChem CID 134944928) has the molecular formula C24H18BrN and a molecular weight of 400.32 g/mol. Its IUPAC name is 4-(4-bromophenyl)-6-methyl-2,3-diphenylpyridine.
| Compound Name | 4-(4-bromophenyl)-6-methyl-2,3-diphenylpyridine |
|---|---|
| PubChem CID | 134944928 |
| Molecular Formula | C24H18BrN |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 4-(4-bromophenyl)-6-methyl-2,3-diphenylpyridine |
| SMILES | Cc1cc(-c2ccc(Br)cc2)c(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C24H18BrN/c1-17-16-22(18-12-14-21(25)15-13-18)23(19-8-4-2-5-9-19)24(26-17)20-10-6-3-7-11-20/h2-16H,1H3 |
| InChIKey | DBNQLFMHBKWVRR-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |