C26H23N — CID 134840610
2,3,4-triphenyl-6-propan-2-ylpyridine (PubChem CID 134840610) has the molecular formula C26H23N and a molecular weight of 349.48 g/mol. Its IUPAC name is 2,3,4-triphenyl-6-propan-2-ylpyridine.
| Compound Name | 2,3,4-triphenyl-6-propan-2-ylpyridine |
|---|---|
| PubChem CID | 134840610 |
| Molecular Formula | C26H23N |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 2,3,4-triphenyl-6-propan-2-ylpyridine |
| SMILES | CC(C)c1cc(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C26H23N/c1-19(2)24-18-23(20-12-6-3-7-13-20)25(21-14-8-4-9-15-21)26(27-24)22-16-10-5-11-17-22/h3-19H,1-2H3 |
| InChIKey | QNUXGYPLWNMJPL-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |