C56H44N4 — CID 90367002
5,11-diphenyl-3,9-di(propan-2-yl)-1,7-bis(3-pyridin-3-ylphenyl)quinolino[8,7-h]quinoline (PubChem CID 90367002) has the molecular formula C56H44N4 and a molecular weight of 773.00 g/mol. Its IUPAC name is 5,11-diphenyl-3,9-di(propan-2-yl)-1,7-bis(3-pyridin-3-ylphenyl)quinolino[8,7-h]quinoline.
| Compound Name | 5,11-diphenyl-3,9-di(propan-2-yl)-1,7-bis(3-pyridin-3-ylphenyl)quinolino[8,7-h]quinoline |
|---|---|
| PubChem CID | 90367002 |
| Molecular Formula | C56H44N4 |
| Molecular Weight | 773.00 g/mol |
| Exact Mass | 772.36 |
| IUPAC Name | 5,11-diphenyl-3,9-di(propan-2-yl)-1,7-bis(3-pyridin-3-ylphenyl)quinolino[8,7-h]quinoline |
| SMILES | CC(C)c1cc(-c2cccc(-c3cccnc3)c2)c2cc(-c3ccccc3)c3c4nc(C(C)C)cc(-c5cccc(-c6cccnc6)c5)c4cc(-c4ccccc4)c3c2n1 |
| InChI | InChI=1S/C56H44N4/c1-35(2)51-31-45(41-21-11-19-39(27-41)43-23-13-25-57-33-43)49-29-48(38-17-9-6-10-18-38)54-53(55(49)59-51)47(37-15-7-5-8-16-37)30-50-46(32-52(36(3)4)60-56(50)54)42-22-12-20-40(28-42)44-24-14-26-58-34-44/h5-36H,1-4H3 |
| InChIKey | MEEFKVXNBJBCJB-UHFFFAOYSA-N |
| XLogP | 14.98 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.00 |
| LogP ≤ 5 | 14.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|