C18H12BrNO — CID 141357196
6-bromo-3-methyl-1-phenyl-[1]benzofuro[2,3-c]pyridine (PubChem CID 141357196) has the molecular formula C18H12BrNO and a molecular weight of 338.20 g/mol. Its IUPAC name is 6-bromo-3-methyl-1-phenyl-[1]benzofuro[2,3-c]pyridine.
| Compound Name | 6-bromo-3-methyl-1-phenyl-[1]benzofuro[2,3-c]pyridine |
|---|---|
| PubChem CID | 141357196 |
| Molecular Formula | C18H12BrNO |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | 6-bromo-3-methyl-1-phenyl-[1]benzofuro[2,3-c]pyridine |
| SMILES | Cc1cc2c(oc3ccc(Br)cc32)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H12BrNO/c1-11-9-15-14-10-13(19)7-8-16(14)21-18(15)17(20-11)12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | VFMMUGLTLOBVKE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |