C30H22BrN3O — CID 142293061
2-(8-bromodibenzofuran-2-yl)-4,6-diphenyl-1,3,5-triazine;prop-1-ene (PubChem CID 142293061) has the molecular formula C30H22BrN3O and a molecular weight of 520.43 g/mol. Its IUPAC name is 2-(8-bromodibenzofuran-2-yl)-4,6-diphenyl-1,3,5-triazine;prop-1-ene.
| Compound Name | 2-(8-bromodibenzofuran-2-yl)-4,6-diphenyl-1,3,5-triazine;prop-1-ene |
|---|---|
| PubChem CID | 142293061 |
| Molecular Formula | C30H22BrN3O |
| Molecular Weight | 520.43 g/mol |
| Exact Mass | 519.09 |
| IUPAC Name | 2-(8-bromodibenzofuran-2-yl)-4,6-diphenyl-1,3,5-triazine;prop-1-ene |
| SMILES | Brc1ccc2oc3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3c2c1.C=CC |
| InChI | InChI=1S/C27H16BrN3O.C3H6/c28-20-12-14-24-22(16-20)21-15-19(11-13-23(21)32-24)27-30-25(17-7-3-1-4-8-17)29-26(31-27)18-9-5-2-6-10-18;1-3-2/h1-16H;3H,1H2,2H3 |
| InChIKey | MZFOAAXOFWICMF-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.43 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|