C27H16BrN3O — CID 147340530
2-(8-bromodibenzofuran-3-yl)-4,6-diphenyl-1,3,5-triazine (PubChem CID 147340530) has the molecular formula C27H16BrN3O and a molecular weight of 478.35 g/mol. Its IUPAC name is 2-(8-bromodibenzofuran-3-yl)-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-(8-bromodibenzofuran-3-yl)-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 147340530 |
| Molecular Formula | C27H16BrN3O |
| Molecular Weight | 478.35 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | 2-(8-bromodibenzofuran-3-yl)-4,6-diphenyl-1,3,5-triazine |
| SMILES | Brc1ccc2oc3cc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)ccc3c2c1 |
| InChI | InChI=1S/C27H16BrN3O/c28-20-12-14-23-22(16-20)21-13-11-19(15-24(21)32-23)27-30-25(17-7-3-1-4-8-17)29-26(31-27)18-9-5-2-6-10-18/h1-16H |
| InChIKey | DDJTYMAJSUAEOM-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.35 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |