C25H28N2OS3 — CID 3337992
2-octylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine (PubChem CID 3337992) has the molecular formula C25H28N2OS3 and a molecular weight of 468.71 g/mol. Its IUPAC name is 2-octylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine.
| Compound Name | 2-octylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 3337992 |
| Molecular Formula | C25H28N2OS3 |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | 2-octylsulfinyl-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-3-amine |
| SMILES | CCCCCCCCS(=O)c1sc2nc(-c3cccs3)cc(-c3ccccc3)c2c1N |
| InChI | InChI=1S/C25H28N2OS3/c1-2-3-4-5-6-10-16-31(28)25-23(26)22-19(18-12-8-7-9-13-18)17-20(27-24(22)30-25)21-14-11-15-29-21/h7-9,11-15,17H,2-6,10,16,26H2,1H3 |
| InChIKey | HQZZZNJJVFUBSZ-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|