C21H20N2O2S3 — CID 118050770
4-(3-amino-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-2-yl)sulfinylbutan-1-ol (PubChem CID 118050770) has the molecular formula C21H20N2O2S3 and a molecular weight of 428.60 g/mol. Its IUPAC name is 4-(3-amino-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-2-yl)sulfinylbutan-1-ol.
| Compound Name | 4-(3-amino-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-2-yl)sulfinylbutan-1-ol |
|---|---|
| PubChem CID | 118050770 |
| Molecular Formula | C21H20N2O2S3 |
| Molecular Weight | 428.60 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | 4-(3-amino-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-2-yl)sulfinylbutan-1-ol |
| SMILES | Nc1c(S(=O)CCCCO)sc2nc(-c3cccs3)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C21H20N2O2S3/c22-19-18-15(14-7-2-1-3-8-14)13-16(17-9-6-11-26-17)23-20(18)27-21(19)28(25)12-5-4-10-24/h1-3,6-9,11,13,24H,4-5,10,12,22H2 |
| InChIKey | QBNOABYMAFOAQZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.60 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|