C20H23F3N2OS3 — CID 92905376
2-[(R)-octylsulfinyl]-6-thiophen-2-yl-4-(trifluoromethyl)thieno[2,3-b]pyridin-3-amine (PubChem CID 92905376) has the molecular formula C20H23F3N2OS3 and a molecular weight of 460.61 g/mol. Its IUPAC name is 2-[(R)-octylsulfinyl]-6-thiophen-2-yl-4-(trifluoromethyl)thieno[2,3-b]pyridin-3-amine.
| Compound Name | 2-[(R)-octylsulfinyl]-6-thiophen-2-yl-4-(trifluoromethyl)thieno[2,3-b]pyridin-3-amine |
|---|---|
| PubChem CID | 92905376 |
| Molecular Formula | C20H23F3N2OS3 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 2-[(R)-octylsulfinyl]-6-thiophen-2-yl-4-(trifluoromethyl)thieno[2,3-b]pyridin-3-amine |
| SMILES | CCCCCCCC[S@@](=O)c1sc2nc(-c3cccs3)cc(C(F)(F)F)c2c1N |
| InChI | InChI=1S/C20H23F3N2OS3/c1-2-3-4-5-6-7-11-29(26)19-17(24)16-13(20(21,22)23)12-14(25-18(16)28-19)15-9-8-10-27-15/h8-10,12H,2-7,11,24H2,1H3/t29-/m1/s1 |
| InChIKey | RZHNPCOZDQTZAN-GDLZYMKVSA-N |
| XLogP | 7.09 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|