C29H29N3O2S3 — CID 157492202
3-amino-2-butylsulfinyl-N,N-dimethyl-6-thiophen-2-ylthieno[2,3-b]pyridine-4-carboxamide;hexa-1,2,3,4,5-pentaene;penta-1,2,3,4-tetraene (PubChem CID 157492202) has the molecular formula C29H29N3O2S3 and a molecular weight of 547.77 g/mol. Its IUPAC name is 3-amino-2-butylsulfinyl-N,N-dimethyl-6-thiophen-2-ylthieno[2,3-b]pyridine-4-carboxamide;hexa-1,2,3,4,5-pentaene;penta-1,2,3,4-tetraene.
| Compound Name | 3-amino-2-butylsulfinyl-N,N-dimethyl-6-thiophen-2-ylthieno[2,3-b]pyridine-4-carboxamide;hexa-1,2,3,4,5-pentaene;penta-1,2,3,4-tetraene |
|---|---|
| PubChem CID | 157492202 |
| Molecular Formula | C29H29N3O2S3 |
| Molecular Weight | 547.77 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 3-amino-2-butylsulfinyl-N,N-dimethyl-6-thiophen-2-ylthieno[2,3-b]pyridine-4-carboxamide;hexa-1,2,3,4,5-pentaene;penta-1,2,3,4-tetraene |
| SMILES | C=C=C=C=C.C=C=C=C=C=C.CCCCS(=O)c1sc2nc(-c3cccs3)cc(C(=O)N(C)C)c2c1N |
| InChI | InChI=1S/C18H21N3O2S3.C6H4.C5H4/c1-4-5-9-26(23)18-15(19)14-11(17(22)21(2)3)10-12(20-16(14)25-18)13-7-6-8-24-13;1-3-5-6-4-2;1-3-5-4-2/h6-8,10H,4-5,9,19H2,1-3H3;1-2H2;1-2H2 |
| InChIKey | BXKKALXIYVYSES-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.77 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |