C23H22N2O3S3 — CID 118050655
4-(3-amino-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-2-yl)sulfinylbutyl acetate (PubChem CID 118050655) has the molecular formula C23H22N2O3S3 and a molecular weight of 470.64 g/mol. Its IUPAC name is 4-(3-amino-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-2-yl)sulfinylbutyl acetate.
| Compound Name | 4-(3-amino-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-2-yl)sulfinylbutyl acetate |
|---|---|
| PubChem CID | 118050655 |
| Molecular Formula | C23H22N2O3S3 |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 4-(3-amino-4-phenyl-6-thiophen-2-ylthieno[2,3-b]pyridin-2-yl)sulfinylbutyl acetate |
| SMILES | CC(=O)OCCCCS(=O)c1sc2nc(-c3cccs3)cc(-c3ccccc3)c2c1N |
| InChI | InChI=1S/C23H22N2O3S3/c1-15(26)28-11-5-6-13-31(27)23-21(24)20-17(16-8-3-2-4-9-16)14-18(25-22(20)30-23)19-10-7-12-29-19/h2-4,7-10,12,14H,5-6,11,13,24H2,1H3 |
| InChIKey | UJFFZNZBRRBDIO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|