About 1-butylindazol-3-amine
1-butylindazol-3-amine (PubChem CID 62686774) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-butylindazol-3-amine.
Molecular Properties
| Compound Name | 1-butylindazol-3-amine |
| PubChem CID | 62686774 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-butylindazol-3-amine |
| SMILES | CCCCn1nc(N)c2ccccc21 |
| InChI | InChI=1S/C11H15N3/c1-2-3-8-14-10-7-5-4-6-9(10)11(12)13-14/h4-7H,2-3,8H2,1H3,(H2,12,13) |
| InChIKey | GNGBCWRFGWCBIT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butylindazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylindazol-3-amine?
The IUPAC name of 1-butylindazol-3-amine (CID 62686774) is 1-butylindazol-3-amine.
What is the SMILES notation for 1-butylindazol-3-amine?
The canonical SMILES for 1-butylindazol-3-amine is CCCCn1nc(N)c2ccccc21.
What is the InChIKey of 1-butylindazol-3-amine?
The InChIKey is GNGBCWRFGWCBIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c1-2-3-8-14-10-7-5-4-6-9(10)11(12)13-14/h4-7H,2-3,8H2,1H3,(H2,12,13).
What are the key properties of 1-butylindazol-3-amine?
1-butylindazol-3-amine has a molecular weight of 189.26 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylindazol-3-amine is sourced from PubChem (CID 62686774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).