About 1-nonylindazol-3-amine
1-nonylindazol-3-amine (PubChem CID 63489930) has the molecular formula C16H25N3
and a molecular weight of 259.40 g/mol. Its IUPAC name is 1-nonylindazol-3-amine.
Molecular Properties
| Compound Name | 1-nonylindazol-3-amine |
| PubChem CID | 63489930 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 1-nonylindazol-3-amine |
| SMILES | CCCCCCCCCn1nc(N)c2ccccc21 |
| InChI | InChI=1S/C16H25N3/c1-2-3-4-5-6-7-10-13-19-15-12-9-8-11-14(15)16(17)18-19/h8-9,11-12H,2-7,10,13H2,1H3,(H2,17,18) |
| InChIKey | WISUGTCKMTZZRS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-nonylindazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nonylindazol-3-amine?
The IUPAC name of 1-nonylindazol-3-amine (CID 63489930) is 1-nonylindazol-3-amine.
What is the SMILES notation for 1-nonylindazol-3-amine?
The canonical SMILES for 1-nonylindazol-3-amine is CCCCCCCCCn1nc(N)c2ccccc21.
What is the InChIKey of 1-nonylindazol-3-amine?
The InChIKey is WISUGTCKMTZZRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3/c1-2-3-4-5-6-7-10-13-19-15-12-9-8-11-14(15)16(17)18-19/h8-9,11-12H,2-7,10,13H2,1H3,(H2,17,18).
What are the key properties of 1-nonylindazol-3-amine?
1-nonylindazol-3-amine has a molecular weight of 259.40 g/mol, XLogP of 4.37, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nonylindazol-3-amine is sourced from PubChem (CID 63489930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).