C19H23N3 — CID 12819473
N,N-diethyl-2-(3-phenylindazol-1-yl)ethanamine (PubChem CID 12819473) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is N,N-diethyl-2-(3-phenylindazol-1-yl)ethanamine.
| Compound Name | N,N-diethyl-2-(3-phenylindazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 12819473 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | N,N-diethyl-2-(3-phenylindazol-1-yl)ethanamine |
| SMILES | CCN(CC)CCn1nc(-c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C19H23N3/c1-3-21(4-2)14-15-22-18-13-9-8-12-17(18)19(20-22)16-10-6-5-7-11-16/h5-13H,3-4,14-15H2,1-2H3 |
| InChIKey | BUABYDYEZDMYKZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |