C22H26N2O2 — CID 25265100
3-[3-(2-hydroxypropan-2-yl)phenyl]-1-pentylcinnolin-4-one (PubChem CID 25265100) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 3-[3-(2-hydroxypropan-2-yl)phenyl]-1-pentylcinnolin-4-one.
| Compound Name | 3-[3-(2-hydroxypropan-2-yl)phenyl]-1-pentylcinnolin-4-one |
|---|---|
| PubChem CID | 25265100 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 3-[3-(2-hydroxypropan-2-yl)phenyl]-1-pentylcinnolin-4-one |
| SMILES | CCCCCn1nc(-c2cccc(C(C)(C)O)c2)c(=O)c2ccccc21 |
| InChI | InChI=1S/C22H26N2O2/c1-4-5-8-14-24-19-13-7-6-12-18(19)21(25)20(23-24)16-10-9-11-17(15-16)22(2,3)26/h6-7,9-13,15,26H,4-5,8,14H2,1-3H3 |
| InChIKey | NJUWRTOQXMQNNB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|