C27H17F3N4O4 — CID 58990886
2-[3-[3-(1,3-dioxoisoindol-2-yl)-5-(trifluoromethyl)indazol-1-yl]propyl]isoindole-1,3-dione (PubChem CID 58990886) has the molecular formula C27H17F3N4O4 and a molecular weight of 518.45 g/mol. Its IUPAC name is 2-[3-[3-(1,3-dioxoisoindol-2-yl)-5-(trifluoromethyl)indazol-1-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[3-(1,3-dioxoisoindol-2-yl)-5-(trifluoromethyl)indazol-1-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 58990886 |
| Molecular Formula | C27H17F3N4O4 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 2-[3-[3-(1,3-dioxoisoindol-2-yl)-5-(trifluoromethyl)indazol-1-yl]propyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCCn1nc(N2C(=O)c3ccccc3C2=O)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C27H17F3N4O4/c28-27(29,30)15-10-11-21-20(14-15)22(34-25(37)18-8-3-4-9-19(18)26(34)38)31-33(21)13-5-12-32-23(35)16-6-1-2-7-17(16)24(32)36/h1-4,6-11,14H,5,12-13H2 |
| InChIKey | DFDJHGPNPYAITA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 92.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|