C21H8F7NO3 — CID 168519679
2-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4,5-difluorophenyl]isoindole-1,3-dione (PubChem CID 168519679) has the molecular formula C21H8F7NO3 and a molecular weight of 455.29 g/mol. Its IUPAC name is 2-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4,5-difluorophenyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4,5-difluorophenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168519679 |
| Molecular Formula | C21H8F7NO3 |
| Molecular Weight | 455.29 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 2-[2-[2,6-difluoro-4-(trifluoromethyl)phenoxy]-4,5-difluorophenyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1c1cc(F)c(F)cc1Oc1c(F)cc(C(F)(F)F)cc1F |
| InChI | InChI=1S/C21H8F7NO3/c22-12-7-16(29-19(30)10-3-1-2-4-11(10)20(29)31)17(8-13(12)23)32-18-14(24)5-9(6-15(18)25)21(26,27)28/h1-8H |
| InChIKey | LXHIJEGGAJMZQR-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.29 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|