C26H29F6NO2 — CID 142789787
4-methyl-2-[5-[2-methyl-1-(trifluoromethyl)piperidin-2-yl]-3-phenyl-2-(trifluoromethyl)phenyl]pentanoic acid (PubChem CID 142789787) has the molecular formula C26H29F6NO2 and a molecular weight of 501.51 g/mol. Its IUPAC name is 4-methyl-2-[5-[2-methyl-1-(trifluoromethyl)piperidin-2-yl]-3-phenyl-2-(trifluoromethyl)phenyl]pentanoic acid.
| Compound Name | 4-methyl-2-[5-[2-methyl-1-(trifluoromethyl)piperidin-2-yl]-3-phenyl-2-(trifluoromethyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 142789787 |
| Molecular Formula | C26H29F6NO2 |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 4-methyl-2-[5-[2-methyl-1-(trifluoromethyl)piperidin-2-yl]-3-phenyl-2-(trifluoromethyl)phenyl]pentanoic acid |
| SMILES | CC(C)CC(C(=O)O)c1cc(C2(C)CCCCN2C(F)(F)F)cc(-c2ccccc2)c1C(F)(F)F |
| InChI | InChI=1S/C26H29F6NO2/c1-16(2)13-21(23(34)35)20-15-18(24(3)11-7-8-12-33(24)26(30,31)32)14-19(22(20)25(27,28)29)17-9-5-4-6-10-17/h4-6,9-10,14-16,21H,7-8,11-13H2,1-3H3,(H,34,35) |
| InChIKey | LVTQLTHCPYEHGA-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|