C25H30F3NO2 — CID 174629347
4-methyl-2-[3-(2-methylpiperidin-1-yl)-5-phenyl-2-(trifluoromethyl)phenyl]pentanoic acid (PubChem CID 174629347) has the molecular formula C25H30F3NO2 and a molecular weight of 433.51 g/mol. Its IUPAC name is 4-methyl-2-[3-(2-methylpiperidin-1-yl)-5-phenyl-2-(trifluoromethyl)phenyl]pentanoic acid.
| Compound Name | 4-methyl-2-[3-(2-methylpiperidin-1-yl)-5-phenyl-2-(trifluoromethyl)phenyl]pentanoic acid |
|---|---|
| PubChem CID | 174629347 |
| Molecular Formula | C25H30F3NO2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 4-methyl-2-[3-(2-methylpiperidin-1-yl)-5-phenyl-2-(trifluoromethyl)phenyl]pentanoic acid |
| SMILES | CC(C)CC(C(=O)O)c1cc(-c2ccccc2)cc(N2CCCCC2C)c1C(F)(F)F |
| InChI | InChI=1S/C25H30F3NO2/c1-16(2)13-21(24(30)31)20-14-19(18-10-5-4-6-11-18)15-22(23(20)25(26,27)28)29-12-8-7-9-17(29)3/h4-6,10-11,14-17,21H,7-9,12-13H2,1-3H3,(H,30,31) |
| InChIKey | UYPSZCDVRACRDC-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |