C23H20N2O5S — CID 56586873
1,3-dioxo-N-[[4-(phenylmethoxymethyl)phenyl]methyl]isoindole-5-sulfonamide (PubChem CID 56586873) has the molecular formula C23H20N2O5S and a molecular weight of 436.49 g/mol. Its IUPAC name is 1,3-dioxo-N-[[4-(phenylmethoxymethyl)phenyl]methyl]isoindole-5-sulfonamide.
| Compound Name | 1,3-dioxo-N-[[4-(phenylmethoxymethyl)phenyl]methyl]isoindole-5-sulfonamide |
|---|---|
| PubChem CID | 56586873 |
| Molecular Formula | C23H20N2O5S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 1,3-dioxo-N-[[4-(phenylmethoxymethyl)phenyl]methyl]isoindole-5-sulfonamide |
| SMILES | O=C1NC(=O)c2cc(S(=O)(=O)NCc3ccc(COCc4ccccc4)cc3)ccc21 |
| InChI | InChI=1S/C23H20N2O5S/c26-22-20-11-10-19(12-21(20)23(27)25-22)31(28,29)24-13-16-6-8-18(9-7-16)15-30-14-17-4-2-1-3-5-17/h1-12,24H,13-15H2,(H,25,26,27) |
| InChIKey | RASBEEOOXHYFDR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|