C15H15N3O6S3 — CID 56587289
N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-1,3-dioxoisoindole-5-sulfonamide (PubChem CID 56587289) has the molecular formula C15H15N3O6S3 and a molecular weight of 429.50 g/mol. Its IUPAC name is N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-1,3-dioxoisoindole-5-sulfonamide.
| Compound Name | N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-1,3-dioxoisoindole-5-sulfonamide |
|---|---|
| PubChem CID | 56587289 |
| Molecular Formula | C15H15N3O6S3 |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]-1,3-dioxoisoindole-5-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(CNS(=O)(=O)c2ccc3c(c2)C(=O)NC3=O)s1 |
| InChI | InChI=1S/C15H15N3O6S3/c1-18(2)27(23,24)13-6-3-9(25-13)8-16-26(21,22)10-4-5-11-12(7-10)15(20)17-14(11)19/h3-7,16H,8H2,1-2H3,(H,17,19,20) |
| InChIKey | KPXKXTSFDACFDO-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|