C12H13BrClN3O4S3 — CID 55904903
5-bromo-2-chloro-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]pyridine-3-sulfonamide (PubChem CID 55904903) has the molecular formula C12H13BrClN3O4S3 and a molecular weight of 474.81 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-chloro-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 55904903 |
| Molecular Formula | C12H13BrClN3O4S3 |
| Molecular Weight | 474.81 g/mol |
| Exact Mass | 472.89 |
| IUPAC Name | 5-bromo-2-chloro-N-[[5-(dimethylsulfamoyl)thiophen-2-yl]methyl]pyridine-3-sulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(CNS(=O)(=O)c2cc(Br)cnc2Cl)s1 |
| InChI | InChI=1S/C12H13BrClN3O4S3/c1-17(2)24(20,21)11-4-3-9(22-11)7-16-23(18,19)10-5-8(13)6-15-12(10)14/h3-6,16H,7H2,1-2H3 |
| InChIKey | SFPZCDONPUOJGO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.81 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|