C14H11N3O4S — CID 59763032
2,3-dioxo-N-(pyridin-4-ylmethyl)-1H-indole-5-sulfonamide (PubChem CID 59763032) has the molecular formula C14H11N3O4S and a molecular weight of 317.33 g/mol. Its IUPAC name is 2,3-dioxo-N-(pyridin-4-ylmethyl)-1H-indole-5-sulfonamide.
| Compound Name | 2,3-dioxo-N-(pyridin-4-ylmethyl)-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 59763032 |
| Molecular Formula | C14H11N3O4S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 2,3-dioxo-N-(pyridin-4-ylmethyl)-1H-indole-5-sulfonamide |
| SMILES | O=C1Nc2ccc(S(=O)(=O)NCc3ccncc3)cc2C1=O |
| InChI | InChI=1S/C14H11N3O4S/c18-13-11-7-10(1-2-12(11)17-14(13)19)22(20,21)16-8-9-3-5-15-6-4-9/h1-7,16H,8H2,(H,17,18,19) |
| InChIKey | OITKBJCFNTVAFG-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|