C14H16N2O4S — CID 126803443
N-[(1-ethylcyclopropyl)methyl]-2,3-dioxo-1H-indole-5-sulfonamide (PubChem CID 126803443) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is N-[(1-ethylcyclopropyl)methyl]-2,3-dioxo-1H-indole-5-sulfonamide.
| Compound Name | N-[(1-ethylcyclopropyl)methyl]-2,3-dioxo-1H-indole-5-sulfonamide |
|---|---|
| PubChem CID | 126803443 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-[(1-ethylcyclopropyl)methyl]-2,3-dioxo-1H-indole-5-sulfonamide |
| SMILES | CCC1(CNS(=O)(=O)c2ccc3c(c2)C(=O)C(=O)N3)CC1 |
| InChI | InChI=1S/C14H16N2O4S/c1-2-14(5-6-14)8-15-21(19,20)9-3-4-11-10(7-9)12(17)13(18)16-11/h3-4,7,15H,2,5-6,8H2,1H3,(H,16,17,18) |
| InChIKey | RPQKBFCWCNEMCL-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|