C12H18N2O4S2 — CID 114101616
2-N-[(1-ethylcyclopropyl)methyl]benzene-1,2-disulfonamide (PubChem CID 114101616) has the molecular formula C12H18N2O4S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-N-[(1-ethylcyclopropyl)methyl]benzene-1,2-disulfonamide.
| Compound Name | 2-N-[(1-ethylcyclopropyl)methyl]benzene-1,2-disulfonamide |
|---|---|
| PubChem CID | 114101616 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 2-N-[(1-ethylcyclopropyl)methyl]benzene-1,2-disulfonamide |
| SMILES | CCC1(CNS(=O)(=O)c2ccccc2S(N)(=O)=O)CC1 |
| InChI | InChI=1S/C12H18N2O4S2/c1-2-12(7-8-12)9-14-20(17,18)11-6-4-3-5-10(11)19(13,15)16/h3-6,14H,2,7-9H2,1H3,(H2,13,15,16) |
| InChIKey | FVVBSIBVJVITLF-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |