C12H17BrN2O2S — CID 115271965
N-[[1-(aminomethyl)cyclobutyl]methyl]-2-bromobenzenesulfonamide (PubChem CID 115271965) has the molecular formula C12H17BrN2O2S and a molecular weight of 333.25 g/mol. Its IUPAC name is N-[[1-(aminomethyl)cyclobutyl]methyl]-2-bromobenzenesulfonamide.
| Compound Name | N-[[1-(aminomethyl)cyclobutyl]methyl]-2-bromobenzenesulfonamide |
|---|---|
| PubChem CID | 115271965 |
| Molecular Formula | C12H17BrN2O2S |
| Molecular Weight | 333.25 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | N-[[1-(aminomethyl)cyclobutyl]methyl]-2-bromobenzenesulfonamide |
| SMILES | NCC1(CNS(=O)(=O)c2ccccc2Br)CCC1 |
| InChI | InChI=1S/C12H17BrN2O2S/c13-10-4-1-2-5-11(10)18(16,17)15-9-12(8-14)6-3-7-12/h1-2,4-5,15H,3,6-9,14H2 |
| InChIKey | SMEUZVAJLNAWNW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |