C19H12ClN3O6S — CID 56582600
N-[5-chloro-2-[(1,3-dioxoisoindol-5-yl)sulfonylamino]phenyl]furan-2-carboxamide (PubChem CID 56582600) has the molecular formula C19H12ClN3O6S and a molecular weight of 445.84 g/mol. Its IUPAC name is N-[5-chloro-2-[(1,3-dioxoisoindol-5-yl)sulfonylamino]phenyl]furan-2-carboxamide.
| Compound Name | N-[5-chloro-2-[(1,3-dioxoisoindol-5-yl)sulfonylamino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 56582600 |
| Molecular Formula | C19H12ClN3O6S |
| Molecular Weight | 445.84 g/mol |
| Exact Mass | 445.01 |
| IUPAC Name | N-[5-chloro-2-[(1,3-dioxoisoindol-5-yl)sulfonylamino]phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1NS(=O)(=O)c1ccc2c(c1)C(=O)NC2=O)c1ccco1 |
| InChI | InChI=1S/C19H12ClN3O6S/c20-10-3-6-14(15(8-10)21-19(26)16-2-1-7-29-16)23-30(27,28)11-4-5-12-13(9-11)18(25)22-17(12)24/h1-9,23H,(H,21,26)(H,22,24,25) |
| InChIKey | KSEXWKKMHNOMMA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.84 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|