C17H12BrClN2O4S — CID 39344896
N-[2-[(2-bromophenyl)sulfonylamino]-5-chlorophenyl]furan-2-carboxamide (PubChem CID 39344896) has the molecular formula C17H12BrClN2O4S and a molecular weight of 455.72 g/mol. Its IUPAC name is N-[2-[(2-bromophenyl)sulfonylamino]-5-chlorophenyl]furan-2-carboxamide.
| Compound Name | N-[2-[(2-bromophenyl)sulfonylamino]-5-chlorophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 39344896 |
| Molecular Formula | C17H12BrClN2O4S |
| Molecular Weight | 455.72 g/mol |
| Exact Mass | 453.94 |
| IUPAC Name | N-[2-[(2-bromophenyl)sulfonylamino]-5-chlorophenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1NS(=O)(=O)c1ccccc1Br)c1ccco1 |
| InChI | InChI=1S/C17H12BrClN2O4S/c18-12-4-1-2-6-16(12)26(23,24)21-13-8-7-11(19)10-14(13)20-17(22)15-5-3-9-25-15/h1-10,21H,(H,20,22) |
| InChIKey | KJPBLGPQYYUWFL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.72 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |