C19H15Cl2N3O3 — CID 60537038
N-[5-chloro-2-[[2-(3-chloroanilino)-2-oxoethyl]amino]phenyl]furan-2-carboxamide (PubChem CID 60537038) has the molecular formula C19H15Cl2N3O3 and a molecular weight of 404.25 g/mol. Its IUPAC name is N-[5-chloro-2-[[2-(3-chloroanilino)-2-oxoethyl]amino]phenyl]furan-2-carboxamide.
| Compound Name | N-[5-chloro-2-[[2-(3-chloroanilino)-2-oxoethyl]amino]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 60537038 |
| Molecular Formula | C19H15Cl2N3O3 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | N-[5-chloro-2-[[2-(3-chloroanilino)-2-oxoethyl]amino]phenyl]furan-2-carboxamide |
| SMILES | O=C(CNc1ccc(Cl)cc1NC(=O)c1ccco1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H15Cl2N3O3/c20-12-3-1-4-14(9-12)23-18(25)11-22-15-7-6-13(21)10-16(15)24-19(26)17-5-2-8-27-17/h1-10,22H,11H2,(H,23,25)(H,24,26) |
| InChIKey | CYXXUTOIRXPLNI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |