C18H12BrClN2O3S — CID 55645244
N-[2-[[(E)-3-(5-bromothiophen-2-yl)prop-2-enoyl]amino]-5-chlorophenyl]furan-2-carboxamide (PubChem CID 55645244) has the molecular formula C18H12BrClN2O3S and a molecular weight of 451.73 g/mol. Its IUPAC name is N-[2-[[(E)-3-(5-bromothiophen-2-yl)prop-2-enoyl]amino]-5-chlorophenyl]furan-2-carboxamide.
| Compound Name | N-[2-[[(E)-3-(5-bromothiophen-2-yl)prop-2-enoyl]amino]-5-chlorophenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55645244 |
| Molecular Formula | C18H12BrClN2O3S |
| Molecular Weight | 451.73 g/mol |
| Exact Mass | 449.94 |
| IUPAC Name | N-[2-[[(E)-3-(5-bromothiophen-2-yl)prop-2-enoyl]amino]-5-chlorophenyl]furan-2-carboxamide |
| SMILES | O=C(/C=C/c1ccc(Br)s1)Nc1ccc(Cl)cc1NC(=O)c1ccco1 |
| InChI | InChI=1S/C18H12BrClN2O3S/c19-16-7-4-12(26-16)5-8-17(23)21-13-6-3-11(20)10-14(13)22-18(24)15-2-1-9-25-15/h1-10H,(H,21,23)(H,22,24)/b8-5+ |
| InChIKey | IUJZTUNYXIYPBA-VMPITWQZSA-N |
| XLogP | 5.66 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.73 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|