C14H10BrClN2O2S — CID 9475553
N'-[(E)-3-(5-bromothiophen-2-yl)prop-2-enoyl]-3-chlorobenzohydrazide (PubChem CID 9475553) has the molecular formula C14H10BrClN2O2S and a molecular weight of 385.67 g/mol. Its IUPAC name is N'-[(E)-3-(5-bromothiophen-2-yl)prop-2-enoyl]-3-chlorobenzohydrazide.
| Compound Name | N'-[(E)-3-(5-bromothiophen-2-yl)prop-2-enoyl]-3-chlorobenzohydrazide |
|---|---|
| PubChem CID | 9475553 |
| Molecular Formula | C14H10BrClN2O2S |
| Molecular Weight | 385.67 g/mol |
| Exact Mass | 383.93 |
| IUPAC Name | N'-[(E)-3-(5-bromothiophen-2-yl)prop-2-enoyl]-3-chlorobenzohydrazide |
| SMILES | O=C(/C=C/c1ccc(Br)s1)NNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H10BrClN2O2S/c15-12-6-4-11(21-12)5-7-13(19)17-18-14(20)9-2-1-3-10(16)8-9/h1-8H,(H,17,19)(H,18,20)/b7-5+ |
| InChIKey | QAKPYZQFRUDKSS-FNORWQNLSA-N |
| XLogP | 3.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.67 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|