C20H15Cl3N2O5S — CID 130311644
5-(3-hydroxyphenoxy)-2-(methanesulfonamido)-N-(3,4,5-trichlorophenyl)benzamide (PubChem CID 130311644) has the molecular formula C20H15Cl3N2O5S and a molecular weight of 501.78 g/mol. Its IUPAC name is 5-(3-hydroxyphenoxy)-2-(methanesulfonamido)-N-(3,4,5-trichlorophenyl)benzamide.
| Compound Name | 5-(3-hydroxyphenoxy)-2-(methanesulfonamido)-N-(3,4,5-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 130311644 |
| Molecular Formula | C20H15Cl3N2O5S |
| Molecular Weight | 501.78 g/mol |
| Exact Mass | 499.98 |
| IUPAC Name | 5-(3-hydroxyphenoxy)-2-(methanesulfonamido)-N-(3,4,5-trichlorophenyl)benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(Oc2cccc(O)c2)cc1C(=O)Nc1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H15Cl3N2O5S/c1-31(28,29)25-18-6-5-14(30-13-4-2-3-12(26)9-13)10-15(18)20(27)24-11-7-16(21)19(23)17(22)8-11/h2-10,25-26H,1H3,(H,24,27) |
| InChIKey | HDJSJFQLQNUOFX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.78 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|