C20H16Cl3N3O3S — CID 125464743
5-anilino-2-(methanesulfonamido)-N-(3,4,5-trichlorophenyl)benzamide (PubChem CID 125464743) has the molecular formula C20H16Cl3N3O3S and a molecular weight of 484.79 g/mol. Its IUPAC name is 5-anilino-2-(methanesulfonamido)-N-(3,4,5-trichlorophenyl)benzamide.
| Compound Name | 5-anilino-2-(methanesulfonamido)-N-(3,4,5-trichlorophenyl)benzamide |
|---|---|
| PubChem CID | 125464743 |
| Molecular Formula | C20H16Cl3N3O3S |
| Molecular Weight | 484.79 g/mol |
| Exact Mass | 483.00 |
| IUPAC Name | 5-anilino-2-(methanesulfonamido)-N-(3,4,5-trichlorophenyl)benzamide |
| SMILES | CS(=O)(=O)Nc1ccc(Nc2ccccc2)cc1C(=O)Nc1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H16Cl3N3O3S/c1-30(28,29)26-18-8-7-13(24-12-5-3-2-4-6-12)9-15(18)20(27)25-14-10-16(21)19(23)17(22)11-14/h2-11,24,26H,1H3,(H,25,27) |
| InChIKey | KAJOUYFACCBWGQ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.79 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|