C12H10BrClN2O4S — CID 106853250
2-bromo-N-[3-chloro-4-(methanesulfonamido)phenyl]furan-3-carboxamide (PubChem CID 106853250) has the molecular formula C12H10BrClN2O4S and a molecular weight of 393.65 g/mol. Its IUPAC name is 2-bromo-N-[3-chloro-4-(methanesulfonamido)phenyl]furan-3-carboxamide.
| Compound Name | 2-bromo-N-[3-chloro-4-(methanesulfonamido)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 106853250 |
| Molecular Formula | C12H10BrClN2O4S |
| Molecular Weight | 393.65 g/mol |
| Exact Mass | 391.92 |
| IUPAC Name | 2-bromo-N-[3-chloro-4-(methanesulfonamido)phenyl]furan-3-carboxamide |
| SMILES | CS(=O)(=O)Nc1ccc(NC(=O)c2ccoc2Br)cc1Cl |
| InChI | InChI=1S/C12H10BrClN2O4S/c1-21(18,19)16-10-3-2-7(6-9(10)14)15-12(17)8-4-5-20-11(8)13/h2-6,16H,1H3,(H,15,17) |
| InChIKey | MNSZEMSMXSUKJI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.65 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |