C21H17Cl3N2O5S — CID 90484937
acetic acid;2,4-dichloro-5-[(4-chlorophenyl)sulfamoyl]-N-phenylbenzamide (PubChem CID 90484937) has the molecular formula C21H17Cl3N2O5S and a molecular weight of 515.80 g/mol. Its IUPAC name is acetic acid;2,4-dichloro-5-[(4-chlorophenyl)sulfamoyl]-N-phenylbenzamide.
| Compound Name | acetic acid;2,4-dichloro-5-[(4-chlorophenyl)sulfamoyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 90484937 |
| Molecular Formula | C21H17Cl3N2O5S |
| Molecular Weight | 515.80 g/mol |
| Exact Mass | 513.99 |
| IUPAC Name | acetic acid;2,4-dichloro-5-[(4-chlorophenyl)sulfamoyl]-N-phenylbenzamide |
| SMILES | CC(=O)O.O=C(Nc1ccccc1)c1cc(S(=O)(=O)Nc2ccc(Cl)cc2)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H13Cl3N2O3S.C2H4O2/c20-12-6-8-14(9-7-12)24-28(26,27)18-10-15(16(21)11-17(18)22)19(25)23-13-4-2-1-3-5-13;1-2(3)4/h1-11,24H,(H,23,25);1H3,(H,3,4) |
| InChIKey | AWWMCCNGVJVQAP-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.80 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |