C21H16O5S — CID 58390695
2-[2-(2-methoxycarbonyl-5-phenylthiophen-3-yl)acetyl]benzoic acid (PubChem CID 58390695) has the molecular formula C21H16O5S and a molecular weight of 380.42 g/mol. Its IUPAC name is 2-[2-(2-methoxycarbonyl-5-phenylthiophen-3-yl)acetyl]benzoic acid.
| Compound Name | 2-[2-(2-methoxycarbonyl-5-phenylthiophen-3-yl)acetyl]benzoic acid |
|---|---|
| PubChem CID | 58390695 |
| Molecular Formula | C21H16O5S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-[2-(2-methoxycarbonyl-5-phenylthiophen-3-yl)acetyl]benzoic acid |
| SMILES | COC(=O)c1sc(-c2ccccc2)cc1CC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C21H16O5S/c1-26-21(25)19-14(12-18(27-19)13-7-3-2-4-8-13)11-17(22)15-9-5-6-10-16(15)20(23)24/h2-10,12H,11H2,1H3,(H,23,24) |
| InChIKey | DWFIWMDKSMYEKJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |