C16H12ClNO5S — CID 2814790
4-[[5-(4-chlorophenyl)-2-methoxycarbonylthiophen-3-yl]amino]-4-oxobut-2-enoic acid (PubChem CID 2814790) has the molecular formula C16H12ClNO5S and a molecular weight of 365.79 g/mol. Its IUPAC name is 4-[[5-(4-chlorophenyl)-2-methoxycarbonylthiophen-3-yl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[5-(4-chlorophenyl)-2-methoxycarbonylthiophen-3-yl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 2814790 |
| Molecular Formula | C16H12ClNO5S |
| Molecular Weight | 365.79 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 4-[[5-(4-chlorophenyl)-2-methoxycarbonylthiophen-3-yl]amino]-4-oxobut-2-enoic acid |
| SMILES | COC(=O)c1sc(-c2ccc(Cl)cc2)cc1NC(=O)C=CC(=O)O |
| InChI | InChI=1S/C16H12ClNO5S/c1-23-16(22)15-11(18-13(19)6-7-14(20)21)8-12(24-15)9-2-4-10(17)5-3-9/h2-8H,1H3,(H,18,19)(H,20,21) |
| InChIKey | TXGSTHFVVXXQSX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.79 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|