C23H23NO4S2 — CID 41324904
ethyl 3-[3-(4-methoxyphenyl)sulfanylpropanoylamino]-5-phenylthiophene-2-carboxylate (PubChem CID 41324904) has the molecular formula C23H23NO4S2 and a molecular weight of 441.57 g/mol. Its IUPAC name is ethyl 3-[3-(4-methoxyphenyl)sulfanylpropanoylamino]-5-phenylthiophene-2-carboxylate.
| Compound Name | ethyl 3-[3-(4-methoxyphenyl)sulfanylpropanoylamino]-5-phenylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 41324904 |
| Molecular Formula | C23H23NO4S2 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | ethyl 3-[3-(4-methoxyphenyl)sulfanylpropanoylamino]-5-phenylthiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc(-c2ccccc2)cc1NC(=O)CCSc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H23NO4S2/c1-3-28-23(26)22-19(15-20(30-22)16-7-5-4-6-8-16)24-21(25)13-14-29-18-11-9-17(27-2)10-12-18/h4-12,15H,3,13-14H2,1-2H3,(H,24,25) |
| InChIKey | ARGZMMNSIPUMOM-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |