C21H18N4O3S — CID 7504335
ethyl 2-[[2-(benzotriazol-1-yl)acetyl]amino]-5-phenylthiophene-3-carboxylate (PubChem CID 7504335) has the molecular formula C21H18N4O3S and a molecular weight of 406.47 g/mol. Its IUPAC name is ethyl 2-[[2-(benzotriazol-1-yl)acetyl]amino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(benzotriazol-1-yl)acetyl]amino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7504335 |
| Molecular Formula | C21H18N4O3S |
| Molecular Weight | 406.47 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | ethyl 2-[[2-(benzotriazol-1-yl)acetyl]amino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=O)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C21H18N4O3S/c1-2-28-21(27)15-12-18(14-8-4-3-5-9-14)29-20(15)22-19(26)13-25-17-11-7-6-10-16(17)23-24-25/h3-12H,2,13H2,1H3,(H,22,26) |
| InChIKey | KHWLXGVTKFDOIC-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |