C16H13Cl2NO3S — CID 28859027
2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-5-ethylthiophene-3-carboxylic acid (PubChem CID 28859027) has the molecular formula C16H13Cl2NO3S and a molecular weight of 370.26 g/mol. Its IUPAC name is 2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-5-ethylthiophene-3-carboxylic acid.
| Compound Name | 2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-5-ethylthiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 28859027 |
| Molecular Formula | C16H13Cl2NO3S |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 2-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]-5-ethylthiophene-3-carboxylic acid |
| SMILES | CCc1cc(C(=O)O)c(NC(=O)/C=C/c2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C16H13Cl2NO3S/c1-2-11-8-12(16(21)22)15(23-11)19-14(20)6-4-9-3-5-10(17)7-13(9)18/h3-8H,2H2,1H3,(H,19,20)(H,21,22)/b6-4+ |
| InChIKey | FTGJBYJWHDUGJD-GQCTYLIASA-N |
| XLogP | 4.97 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|