C18H27N3O5 — CID 143924829
2-hydroxy-5-[2-(2,2,4-trimethylpentanoylamino)ethylcarbamoylamino]benzoic acid (PubChem CID 143924829) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-hydroxy-5-[2-(2,2,4-trimethylpentanoylamino)ethylcarbamoylamino]benzoic acid.
| Compound Name | 2-hydroxy-5-[2-(2,2,4-trimethylpentanoylamino)ethylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 143924829 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 2-hydroxy-5-[2-(2,2,4-trimethylpentanoylamino)ethylcarbamoylamino]benzoic acid |
| SMILES | CC(C)CC(C)(C)C(=O)NCCNC(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C18H27N3O5/c1-11(2)10-18(3,4)16(25)19-7-8-20-17(26)21-12-5-6-14(22)13(9-12)15(23)24/h5-6,9,11,22H,7-8,10H2,1-4H3,(H,19,25)(H,23,24)(H2,20,21,26) |
| InChIKey | PCFZNHBYROZUSN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|