C14H20N2O4 — CID 104829215
5-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-hydroxybenzoic acid (PubChem CID 104829215) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 5-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-hydroxybenzoic acid.
| Compound Name | 5-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 104829215 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 5-(3,3-dimethylbutan-2-ylcarbamoylamino)-2-hydroxybenzoic acid |
| SMILES | CC(NC(=O)Nc1ccc(O)c(C(=O)O)c1)C(C)(C)C |
| InChI | InChI=1S/C14H20N2O4/c1-8(14(2,3)4)15-13(20)16-9-5-6-11(17)10(7-9)12(18)19/h5-8,17H,1-4H3,(H,18,19)(H2,15,16,20) |
| InChIKey | IEMCLAPYLDBXKF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|