C14H13N3O4 — CID 61200541
2-hydroxy-5-(pyridin-4-ylmethylcarbamoylamino)benzoic acid (PubChem CID 61200541) has the molecular formula C14H13N3O4 and a molecular weight of 287.28 g/mol. Its IUPAC name is 2-hydroxy-5-(pyridin-4-ylmethylcarbamoylamino)benzoic acid.
| Compound Name | 2-hydroxy-5-(pyridin-4-ylmethylcarbamoylamino)benzoic acid |
|---|---|
| PubChem CID | 61200541 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-hydroxy-5-(pyridin-4-ylmethylcarbamoylamino)benzoic acid |
| SMILES | O=C(NCc1ccncc1)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H13N3O4/c18-12-2-1-10(7-11(12)13(19)20)17-14(21)16-8-9-3-5-15-6-4-9/h1-7,18H,8H2,(H,19,20)(H2,16,17,21) |
| InChIKey | OQEXBSTUROTLCB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|