C13H13ClN3O3S+ — CID 142402002
CID 142402002 (PubChem CID 142402002) has the molecular formula C13H13ClN3O3S+ and a molecular weight of 326.79 g/mol.
| Compound Name | CID 142402002 |
|---|---|
| PubChem CID | 142402002 |
| Molecular Formula | C13H13ClN3O3S+ |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | — |
| SMILES | O=C(NCc1ccncc1)Nc1ccc([S+](=O)(O)Cl)cc1 |
| InChI | InChI=1S/C13H12ClN3O3S/c14-21(19,20)12-3-1-11(2-4-12)17-13(18)16-9-10-5-7-15-8-6-10/h1-8H,9H2,(H2-,16,17,18,19,20)/p+1 |
| InChIKey | MRGSBRYWAXCLTQ-UHFFFAOYSA-O |
| XLogP | 2.89 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|