C32H45NO6 — CID 77473422
2-[(2-hydroxybenzoyl)amino]ethyl 2-icosa-5,8,11,14,17-pentaenoxy-2-methoxyacetate (PubChem CID 77473422) has the molecular formula C32H45NO6 and a molecular weight of 539.71 g/mol. Its IUPAC name is 2-[(2-hydroxybenzoyl)amino]ethyl 2-icosa-5,8,11,14,17-pentaenoxy-2-methoxyacetate.
| Compound Name | 2-[(2-hydroxybenzoyl)amino]ethyl 2-icosa-5,8,11,14,17-pentaenoxy-2-methoxyacetate |
|---|---|
| PubChem CID | 77473422 |
| Molecular Formula | C32H45NO6 |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | 2-[(2-hydroxybenzoyl)amino]ethyl 2-icosa-5,8,11,14,17-pentaenoxy-2-methoxyacetate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCOC(OC)C(=O)OCCNC(=O)c1ccccc1O |
| InChI | InChI=1S/C32H45NO6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22-26-39-32(37-2)31(36)38-27-25-33-30(35)28-23-20-21-24-29(28)34/h4-5,7-8,10-11,13-14,16-17,20-21,23-24,32,34H,3,6,9,12,15,18-19,22,25-27H2,1-2H3,(H,33,35) |
| InChIKey | FGPUWMQXCNLAPU-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|